C21H21ClN2O3S — CID 39736579
N-[(5-chlorothiophen-2-yl)methyl]-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-prop-2-enylbenzamide (PubChem CID 39736579) has the molecular formula C21H21ClN2O3S and a molecular weight of 416.93 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-prop-2-enylbenzamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 39736579 |
| Molecular Formula | C21H21ClN2O3S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)c1ccc(OCc2c(C)noc2C)cc1 |
| InChI | InChI=1S/C21H21ClN2O3S/c1-4-11-24(12-18-9-10-20(22)28-18)21(25)16-5-7-17(8-6-16)26-13-19-14(2)23-27-15(19)3/h4-10H,1,11-13H2,2-3H3 |
| InChIKey | GQPZPTQFHYDEMH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|