C14H18Cl2N2O — CID 30597
[2-(3-chloroanilino)-2-oxoethyl]-bis(prop-2-enyl)azanium chloride (PubChem CID 30597) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl]-bis(prop-2-enyl)azanium chloride.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl]-bis(prop-2-enyl)azanium chloride |
|---|---|
| PubChem CID | 30597 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl]-bis(prop-2-enyl)azanium chloride |
| SMILES | C=CC[NH+](CC=C)CC(=O)Nc1cccc(Cl)c1.[Cl-] |
| InChI | InChI=1S/C14H17ClN2O.ClH/c1-3-8-17(9-4-2)11-14(18)16-13-7-5-6-12(15)10-13;/h3-7,10H,1-2,8-9,11H2,(H,16,18);1H |
| InChIKey | OFNRWBRVAONDEX-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|