C17H19ClN3O2S+ — CID 9298328
[2-(4-carbamoylanilino)-2-oxoethyl]-[(5-chlorothiophen-2-yl)methyl]-prop-2-enylazanium (PubChem CID 9298328) has the molecular formula C17H19ClN3O2S+ and a molecular weight of 364.88 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl]-[(5-chlorothiophen-2-yl)methyl]-prop-2-enylazanium.
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl]-[(5-chlorothiophen-2-yl)methyl]-prop-2-enylazanium |
|---|---|
| PubChem CID | 9298328 |
| Molecular Formula | C17H19ClN3O2S+ |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl]-[(5-chlorothiophen-2-yl)methyl]-prop-2-enylazanium |
| SMILES | C=CC[NH+](CC(=O)Nc1ccc(C(N)=O)cc1)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C17H18ClN3O2S/c1-2-9-21(10-14-7-8-15(18)24-14)11-16(22)20-13-5-3-12(4-6-13)17(19)23/h2-8H,1,9-11H2,(H2,19,23)(H,20,22)/p+1 |
| InChIKey | OPNUJWQHAOVFJQ-UHFFFAOYSA-O |
| XLogP | 1.71 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|