C16H21ClN3OS+ — CID 9298661
(5-chlorothiophen-2-yl)methyl-[2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl]-prop-2-enylazanium (PubChem CID 9298661) has the molecular formula C16H21ClN3OS+ and a molecular weight of 338.88 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)methyl-[2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl]-prop-2-enylazanium.
| Compound Name | (5-chlorothiophen-2-yl)methyl-[2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl]-prop-2-enylazanium |
|---|---|
| PubChem CID | 9298661 |
| Molecular Formula | C16H21ClN3OS+ |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (5-chlorothiophen-2-yl)methyl-[2-[[(1R)-1-cyano-1-cyclopropylethyl]amino]-2-oxoethyl]-prop-2-enylazanium |
| SMILES | C=CC[NH+](CC(=O)N[C@@](C)(C#N)C1CC1)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C16H20ClN3OS/c1-3-8-20(9-13-6-7-14(17)22-13)10-15(21)19-16(2,11-18)12-4-5-12/h3,6-7,12H,1,4-5,8-10H2,2H3,(H,19,21)/p+1/t16-/m0/s1 |
| InChIKey | LUFQFHJANWEYTD-INIZCTEOSA-O |
| XLogP | 1.78 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|