C17H18ClFN3O2S+ — CID 9298126
(5-chlorothiophen-2-yl)methyl-[2-[(2-fluorophenyl)carbamoylamino]-2-oxoethyl]-prop-2-enylazanium (PubChem CID 9298126) has the molecular formula C17H18ClFN3O2S+ and a molecular weight of 382.87 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)methyl-[2-[(2-fluorophenyl)carbamoylamino]-2-oxoethyl]-prop-2-enylazanium.
| Compound Name | (5-chlorothiophen-2-yl)methyl-[2-[(2-fluorophenyl)carbamoylamino]-2-oxoethyl]-prop-2-enylazanium |
|---|---|
| PubChem CID | 9298126 |
| Molecular Formula | C17H18ClFN3O2S+ |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | (5-chlorothiophen-2-yl)methyl-[2-[(2-fluorophenyl)carbamoylamino]-2-oxoethyl]-prop-2-enylazanium |
| SMILES | C=CC[NH+](CC(=O)NC(=O)Nc1ccccc1F)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C17H17ClFN3O2S/c1-2-9-22(10-12-7-8-15(18)25-12)11-16(23)21-17(24)20-14-6-4-3-5-13(14)19/h2-8H,1,9-11H2,(H2,20,21,23,24)/p+1 |
| InChIKey | LZHLJBVDWCWHCB-UHFFFAOYSA-O |
| XLogP | 2.46 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|