C16H16Cl2N3O3S+ — CID 9298432
[2-(4-chloro-2-nitroanilino)-2-oxoethyl]-[(5-chlorothiophen-2-yl)methyl]-prop-2-enylazanium (PubChem CID 9298432) has the molecular formula C16H16Cl2N3O3S+ and a molecular weight of 401.30 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl]-[(5-chlorothiophen-2-yl)methyl]-prop-2-enylazanium.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl]-[(5-chlorothiophen-2-yl)methyl]-prop-2-enylazanium |
|---|---|
| PubChem CID | 9298432 |
| Molecular Formula | C16H16Cl2N3O3S+ |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl]-[(5-chlorothiophen-2-yl)methyl]-prop-2-enylazanium |
| SMILES | C=CC[NH+](CC(=O)Nc1ccc(Cl)cc1[N+](=O)[O-])Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C16H15Cl2N3O3S/c1-2-7-20(9-12-4-6-15(18)25-12)10-16(22)19-13-5-3-11(17)8-14(13)21(23)24/h2-6,8H,1,7,9-10H2,(H,19,22)/p+1 |
| InChIKey | YJWFLTYJTJUEPJ-UHFFFAOYSA-O |
| XLogP | 3.17 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|