C18H21ClN3O4S+ — CID 8773781
(5-chlorothiophen-2-yl)methyl-[(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl]-prop-2-enylazanium (PubChem CID 8773781) has the molecular formula C18H21ClN3O4S+ and a molecular weight of 410.90 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)methyl-[(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl]-prop-2-enylazanium.
| Compound Name | (5-chlorothiophen-2-yl)methyl-[(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl]-prop-2-enylazanium |
|---|---|
| PubChem CID | 8773781 |
| Molecular Formula | C18H21ClN3O4S+ |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (5-chlorothiophen-2-yl)methyl-[(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl]-prop-2-enylazanium |
| SMILES | C=CC[NH+](Cc1ccc(Cl)s1)[C@@H](C)C(=O)Nc1ccc([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H20ClN3O4S/c1-4-9-21(11-14-6-8-17(19)27-14)12(2)18(23)20-15-7-5-13(22(24)25)10-16(15)26-3/h4-8,10,12H,1,9,11H2,2-3H3,(H,20,23)/p+1/t12-/m0/s1 |
| InChIKey | YWYPSJVOFHVDGG-LBPRGKRZSA-O |
| XLogP | 2.92 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|