C13H16N2O7 — CID 8018796
[(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 2-methoxyacetate (PubChem CID 8018796) has the molecular formula C13H16N2O7 and a molecular weight of 312.28 g/mol. Its IUPAC name is [(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 2-methoxyacetate.
| Compound Name | [(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 2-methoxyacetate |
|---|---|
| PubChem CID | 8018796 |
| Molecular Formula | C13H16N2O7 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | [(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 2-methoxyacetate |
| SMILES | COCC(=O)O[C@@H](C)C(=O)Nc1ccc([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C13H16N2O7/c1-8(22-12(16)7-20-2)13(17)14-10-5-4-9(15(18)19)6-11(10)21-3/h4-6,8H,7H2,1-3H3,(H,14,17)/t8-/m0/s1 |
| InChIKey | YVMDJHUACPXTPZ-QMMMGPOBSA-N |
| XLogP | 1.12 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|