C20H22N2O6S — CID 7788619
[(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 2-(2,5-dimethylphenyl)sulfanylacetate (PubChem CID 7788619) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is [(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 2-(2,5-dimethylphenyl)sulfanylacetate.
| Compound Name | [(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 2-(2,5-dimethylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7788619 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | [(2S)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl] 2-(2,5-dimethylphenyl)sulfanylacetate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)[C@H](C)OC(=O)CSc1cc(C)ccc1C |
| InChI | InChI=1S/C20H22N2O6S/c1-12-5-6-13(2)18(9-12)29-11-19(23)28-14(3)20(24)21-16-8-7-15(22(25)26)10-17(16)27-4/h5-10,14H,11H2,1-4H3,(H,21,24)/t14-/m0/s1 |
| InChIKey | MKPBMCYZRQECQD-AWEZNQCLSA-N |
| XLogP | 3.88 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|