C23H26N3O5+ — CID 9054234
(6-methoxynaphthalen-2-yl)methyl-[(2R)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl]-methylazanium (PubChem CID 9054234) has the molecular formula C23H26N3O5+ and a molecular weight of 424.48 g/mol. Its IUPAC name is (6-methoxynaphthalen-2-yl)methyl-[(2R)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl]-methylazanium.
| Compound Name | (6-methoxynaphthalen-2-yl)methyl-[(2R)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 9054234 |
| Molecular Formula | C23H26N3O5+ |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (6-methoxynaphthalen-2-yl)methyl-[(2R)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl]-methylazanium |
| SMILES | COc1ccc2cc(C[NH+](C)[C@H](C)C(=O)Nc3ccc([N+](=O)[O-])cc3OC)ccc2c1 |
| InChI | InChI=1S/C23H25N3O5/c1-15(23(27)24-21-10-8-19(26(28)29)13-22(21)31-4)25(2)14-16-5-6-18-12-20(30-3)9-7-17(18)11-16/h5-13,15H,14H2,1-4H3,(H,24,27)/p+1/t15-/m1/s1 |
| InChIKey | HCTXIRDPTXTRHB-OAHLLOKOSA-O |
| XLogP | 2.81 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|