C20H26N3O4+ — CID 8515680
(4-ethylphenyl)methyl-[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methylazanium (PubChem CID 8515680) has the molecular formula C20H26N3O4+ and a molecular weight of 372.45 g/mol. Its IUPAC name is (4-ethylphenyl)methyl-[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methylazanium.
| Compound Name | (4-ethylphenyl)methyl-[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 8515680 |
| Molecular Formula | C20H26N3O4+ |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (4-ethylphenyl)methyl-[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methylazanium |
| SMILES | CCc1ccc(C[NH+](C)[C@@H](C)C(=O)Nc2cc([N+](=O)[O-])ccc2OC)cc1 |
| InChI | InChI=1S/C20H25N3O4/c1-5-15-6-8-16(9-7-15)13-22(3)14(2)20(24)21-18-12-17(23(25)26)10-11-19(18)27-4/h6-12,14H,5,13H2,1-4H3,(H,21,24)/p+1/t14-/m0/s1 |
| InChIKey | MVHNDJZTIMNDMK-AWEZNQCLSA-O |
| XLogP | 2.21 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|