C17H22N3O4S+ — CID 9433868
[(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methyl-[(3-methylthiophen-2-yl)methyl]azanium (PubChem CID 9433868) has the molecular formula C17H22N3O4S+ and a molecular weight of 364.45 g/mol. Its IUPAC name is [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methyl-[(3-methylthiophen-2-yl)methyl]azanium.
| Compound Name | [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methyl-[(3-methylthiophen-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 9433868 |
| Molecular Formula | C17H22N3O4S+ |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methyl-[(3-methylthiophen-2-yl)methyl]azanium |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H](C)[NH+](C)Cc1sccc1C |
| InChI | InChI=1S/C17H21N3O4S/c1-11-7-8-25-16(11)10-19(3)12(2)17(21)18-14-9-13(20(22)23)5-6-15(14)24-4/h5-9,12H,10H2,1-4H3,(H,18,21)/p+1/t12-/m1/s1 |
| InChIKey | ZWUIYWPKGBCARW-GFCCVEGCSA-O |
| XLogP | 2.02 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|