C20H25N4O5S+ — CID 2608985
[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium (PubChem CID 2608985) has the molecular formula C20H25N4O5S+ and a molecular weight of 433.51 g/mol. Its IUPAC name is [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium.
| Compound Name | [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 2608985 |
| Molecular Formula | C20H25N4O5S+ |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)[NH+](C)CC(=O)Nc1ccccc1SC |
| InChI | InChI=1S/C20H24N4O5S/c1-13(20(26)22-16-11-14(24(27)28)9-10-17(16)29-3)23(2)12-19(25)21-15-7-5-6-8-18(15)30-4/h5-11,13H,12H2,1-4H3,(H,21,25)(H,22,26)/p+1/t13-/m0/s1 |
| InChIKey | OEWOXKYFYPDJED-ZDUSSCGKSA-O |
| XLogP | 1.81 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|