C21H28N3O6+ — CID 8550948
(4,5-dimethoxy-2-methylphenyl)methyl-[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methylazanium (PubChem CID 8550948) has the molecular formula C21H28N3O6+ and a molecular weight of 418.47 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl)methyl-[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methylazanium.
| Compound Name | (4,5-dimethoxy-2-methylphenyl)methyl-[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 8550948 |
| Molecular Formula | C21H28N3O6+ |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl)methyl-[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methylazanium |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)[NH+](C)Cc1cc(OC)c(OC)cc1C |
| InChI | InChI=1S/C21H27N3O6/c1-13-9-19(29-5)20(30-6)10-15(13)12-23(3)14(2)21(25)22-17-11-16(24(26)27)7-8-18(17)28-4/h7-11,14H,12H2,1-6H3,(H,22,25)/p+1/t14-/m0/s1 |
| InChIKey | WWQNYDIHLFIYGU-AWEZNQCLSA-O |
| XLogP | 1.97 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|