C19H23FN3O5+ — CID 9432359
(3-fluoro-4-methoxyphenyl)methyl-[(2R)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl]-methylazanium (PubChem CID 9432359) has the molecular formula C19H23FN3O5+ and a molecular weight of 392.41 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl-[(2R)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl]-methylazanium.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl-[(2R)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 9432359 |
| Molecular Formula | C19H23FN3O5+ |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl-[(2R)-1-(2-methoxy-4-nitroanilino)-1-oxopropan-2-yl]-methylazanium |
| SMILES | COc1ccc(C[NH+](C)[C@H](C)C(=O)Nc2ccc([N+](=O)[O-])cc2OC)cc1F |
| InChI | InChI=1S/C19H22FN3O5/c1-12(22(2)11-13-5-8-17(27-3)15(20)9-13)19(24)21-16-7-6-14(23(25)26)10-18(16)28-4/h5-10,12H,11H2,1-4H3,(H,21,24)/p+1/t12-/m1/s1 |
| InChIKey | FZJQRIBNQXQTGS-GFCCVEGCSA-O |
| XLogP | 1.79 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|