C19H22N3O6+ — CID 8746296
1,3-benzodioxol-5-ylmethyl-[(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methylazanium (PubChem CID 8746296) has the molecular formula C19H22N3O6+ and a molecular weight of 388.40 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl-[(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methylazanium.
| Compound Name | 1,3-benzodioxol-5-ylmethyl-[(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 8746296 |
| Molecular Formula | C19H22N3O6+ |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl-[(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]-methylazanium |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H](C)[NH+](C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H21N3O6/c1-12(21(2)10-13-4-6-17-18(8-13)28-11-27-17)19(23)20-15-9-14(22(24)25)5-7-16(15)26-3/h4-9,12H,10-11H2,1-3H3,(H,20,23)/p+1/t12-/m1/s1 |
| InChIKey | MCYHGRLZXSMUNJ-GFCCVEGCSA-O |
| XLogP | 1.37 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|