C20H24N4O6 — CID 7870057
(2S)-2-[2-[2-(4-ethylphenoxy)acetyl]hydrazinyl]-N-(2-methoxy-5-nitrophenyl)propanamide (PubChem CID 7870057) has the molecular formula C20H24N4O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is (2S)-2-[2-[2-(4-ethylphenoxy)acetyl]hydrazinyl]-N-(2-methoxy-5-nitrophenyl)propanamide.
| Compound Name | (2S)-2-[2-[2-(4-ethylphenoxy)acetyl]hydrazinyl]-N-(2-methoxy-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 7870057 |
| Molecular Formula | C20H24N4O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (2S)-2-[2-[2-(4-ethylphenoxy)acetyl]hydrazinyl]-N-(2-methoxy-5-nitrophenyl)propanamide |
| SMILES | CCc1ccc(OCC(=O)NN[C@@H](C)C(=O)Nc2cc([N+](=O)[O-])ccc2OC)cc1 |
| InChI | InChI=1S/C20H24N4O6/c1-4-14-5-8-16(9-6-14)30-12-19(25)23-22-13(2)20(26)21-17-11-15(24(27)28)7-10-18(17)29-3/h5-11,13,22H,4,12H2,1-3H3,(H,21,26)(H,23,25)/t13-/m0/s1 |
| InChIKey | NTZCOFREKHRMPT-ZDUSSCGKSA-N |
| XLogP | 2.19 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|