C19H22ClFN2OS — CID 42288549
3-[(3S)-1-[(5-chlorothiophen-2-yl)methyl]piperidin-3-yl]-N-(2-fluorophenyl)propanamide (PubChem CID 42288549) has the molecular formula C19H22ClFN2OS and a molecular weight of 380.92 g/mol. Its IUPAC name is 3-[(3S)-1-[(5-chlorothiophen-2-yl)methyl]piperidin-3-yl]-N-(2-fluorophenyl)propanamide.
| Compound Name | 3-[(3S)-1-[(5-chlorothiophen-2-yl)methyl]piperidin-3-yl]-N-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 42288549 |
| Molecular Formula | C19H22ClFN2OS |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 3-[(3S)-1-[(5-chlorothiophen-2-yl)methyl]piperidin-3-yl]-N-(2-fluorophenyl)propanamide |
| SMILES | O=C(CC[C@@H]1CCCN(Cc2ccc(Cl)s2)C1)Nc1ccccc1F |
| InChI | InChI=1S/C19H22ClFN2OS/c20-18-9-8-15(25-18)13-23-11-3-4-14(12-23)7-10-19(24)22-17-6-2-1-5-16(17)21/h1-2,5-6,8-9,14H,3-4,7,10-13H2,(H,22,24)/t14-/m0/s1 |
| InChIKey | HHOVNNGBIJEGAR-AWEZNQCLSA-N |
| XLogP | 5.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |