C22H31FN4O — CID 45224423
N-(2-fluorophenyl)-3-[1-[(5-methyl-1-propylpyrazol-4-yl)methyl]piperidin-3-yl]propanamide (PubChem CID 45224423) has the molecular formula C22H31FN4O and a molecular weight of 386.52 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-[1-[(5-methyl-1-propylpyrazol-4-yl)methyl]piperidin-3-yl]propanamide.
| Compound Name | N-(2-fluorophenyl)-3-[1-[(5-methyl-1-propylpyrazol-4-yl)methyl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 45224423 |
| Molecular Formula | C22H31FN4O |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | N-(2-fluorophenyl)-3-[1-[(5-methyl-1-propylpyrazol-4-yl)methyl]piperidin-3-yl]propanamide |
| SMILES | CCCn1ncc(CN2CCCC(CCC(=O)Nc3ccccc3F)C2)c1C |
| InChI | InChI=1S/C22H31FN4O/c1-3-12-27-17(2)19(14-24-27)16-26-13-6-7-18(15-26)10-11-22(28)25-21-9-5-4-8-20(21)23/h4-5,8-9,14,18H,3,6-7,10-13,15-16H2,1-2H3,(H,25,28) |
| InChIKey | KORLUOYBPWQXEV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |