C22H27FN2OS — CID 45187738
N-(2-fluorophenyl)-3-[1-[(4-methylsulfanylphenyl)methyl]piperidin-3-yl]propanamide (PubChem CID 45187738) has the molecular formula C22H27FN2OS and a molecular weight of 386.54 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-[1-[(4-methylsulfanylphenyl)methyl]piperidin-3-yl]propanamide.
| Compound Name | N-(2-fluorophenyl)-3-[1-[(4-methylsulfanylphenyl)methyl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 45187738 |
| Molecular Formula | C22H27FN2OS |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-(2-fluorophenyl)-3-[1-[(4-methylsulfanylphenyl)methyl]piperidin-3-yl]propanamide |
| SMILES | CSc1ccc(CN2CCCC(CCC(=O)Nc3ccccc3F)C2)cc1 |
| InChI | InChI=1S/C22H27FN2OS/c1-27-19-11-8-18(9-12-19)16-25-14-4-5-17(15-25)10-13-22(26)24-21-7-3-2-6-20(21)23/h2-3,6-9,11-12,17H,4-5,10,13-16H2,1H3,(H,24,26) |
| InChIKey | HHTPTPCWCRDADW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |