C16H19BrN3O2S+ — CID 8971807
(5-bromothiophen-2-yl)methyl-methyl-[2-[3-(methylcarbamoyl)anilino]-2-oxoethyl]azanium (PubChem CID 8971807) has the molecular formula C16H19BrN3O2S+ and a molecular weight of 397.32 g/mol. Its IUPAC name is (5-bromothiophen-2-yl)methyl-methyl-[2-[3-(methylcarbamoyl)anilino]-2-oxoethyl]azanium.
| Compound Name | (5-bromothiophen-2-yl)methyl-methyl-[2-[3-(methylcarbamoyl)anilino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8971807 |
| Molecular Formula | C16H19BrN3O2S+ |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | (5-bromothiophen-2-yl)methyl-methyl-[2-[3-(methylcarbamoyl)anilino]-2-oxoethyl]azanium |
| SMILES | CNC(=O)c1cccc(NC(=O)C[NH+](C)Cc2ccc(Br)s2)c1 |
| InChI | InChI=1S/C16H18BrN3O2S/c1-18-16(22)11-4-3-5-12(8-11)19-15(21)10-20(2)9-13-6-7-14(17)23-13/h3-8H,9-10H2,1-2H3,(H,18,22)(H,19,21)/p+1 |
| InChIKey | IMNUHTIIOHBGAE-UHFFFAOYSA-O |
| XLogP | 1.52 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |