C9H8BrNO3S — CID 7712568
(2-amino-2-oxoethyl) (E)-3-(5-bromothiophen-2-yl)prop-2-enoate (PubChem CID 7712568) has the molecular formula C9H8BrNO3S and a molecular weight of 290.14 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (E)-3-(5-bromothiophen-2-yl)prop-2-enoate.
| Compound Name | (2-amino-2-oxoethyl) (E)-3-(5-bromothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7712568 |
| Molecular Formula | C9H8BrNO3S |
| Molecular Weight | 290.14 g/mol |
| Exact Mass | 288.94 |
| IUPAC Name | (2-amino-2-oxoethyl) (E)-3-(5-bromothiophen-2-yl)prop-2-enoate |
| SMILES | NC(=O)COC(=O)/C=C/c1ccc(Br)s1 |
| InChI | InChI=1S/C9H8BrNO3S/c10-7-3-1-6(15-7)2-4-9(13)14-5-8(11)12/h1-4H,5H2,(H2,11,12)/b4-2+ |
| InChIKey | OAYAHPDOMCXMGD-DUXPYHPUSA-N |
| XLogP | 1.55 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.14 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|