C17H12BrNO3S — CID 7712560
(5-phenyl-1,3-oxazol-2-yl)methyl (E)-3-(5-bromothiophen-2-yl)prop-2-enoate (PubChem CID 7712560) has the molecular formula C17H12BrNO3S and a molecular weight of 390.26 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl (E)-3-(5-bromothiophen-2-yl)prop-2-enoate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl (E)-3-(5-bromothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7712560 |
| Molecular Formula | C17H12BrNO3S |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl (E)-3-(5-bromothiophen-2-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Br)s1)OCc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H12BrNO3S/c18-15-8-6-13(23-15)7-9-17(20)21-11-16-19-10-14(22-16)12-4-2-1-3-5-12/h1-10H,11H2/b9-7+ |
| InChIKey | IQUNFYKOTFMUCO-VQHVLOKHSA-N |
| XLogP | 4.92 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|