C20H16BrNO4 — CID 7971522
(5-phenyl-1,3-oxazol-2-yl)methyl (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate (PubChem CID 7971522) has the molecular formula C20H16BrNO4 and a molecular weight of 414.26 g/mol. Its IUPAC name is (5-phenyl-1,3-oxazol-2-yl)methyl (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate.
| Compound Name | (5-phenyl-1,3-oxazol-2-yl)methyl (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7971522 |
| Molecular Formula | C20H16BrNO4 |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | (5-phenyl-1,3-oxazol-2-yl)methyl (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)OCc1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C20H16BrNO4/c1-24-17-9-8-16(21)11-15(17)7-10-20(23)25-13-19-22-12-18(26-19)14-5-3-2-4-6-14/h2-12H,13H2,1H3/b10-7+ |
| InChIKey | SWUXSLQEVVHBMU-JXMROGBWSA-N |
| XLogP | 4.87 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|