C16H17BrN2O4 — CID 46528616
(3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate (PubChem CID 46528616) has the molecular formula C16H17BrN2O4 and a molecular weight of 381.23 g/mol. Its IUPAC name is (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate.
| Compound Name | (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 46528616 |
| Molecular Formula | C16H17BrN2O4 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | (3-propan-2-yl-1,2,4-oxadiazol-5-yl)methyl (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)OCc1nc(C(C)C)no1 |
| InChI | InChI=1S/C16H17BrN2O4/c1-10(2)16-18-14(23-19-16)9-22-15(20)7-4-11-8-12(17)5-6-13(11)21-3/h4-8,10H,9H2,1-3H3/b7-4+ |
| InChIKey | HTLWVIZGIDAWTA-QPJJXVBHSA-N |
| XLogP | 3.72 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|