C17H17BrN2O5 — CID 8945737
[(2S)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate (PubChem CID 8945737) has the molecular formula C17H17BrN2O5 and a molecular weight of 409.24 g/mol. Its IUPAC name is [(2S)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8945737 |
| Molecular Formula | C17H17BrN2O5 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | [(2S)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl] (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)O[C@@H](C)C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C17H17BrN2O5/c1-10-8-15(20-25-10)19-17(22)11(2)24-16(21)7-4-12-9-13(18)5-6-14(12)23-3/h4-9,11H,1-3H3,(H,19,20,22)/b7-4+/t11-/m0/s1 |
| InChIKey | ZCVSIJPIJOGVMV-ZPMKCOPCSA-N |
| XLogP | 3.34 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|