C16H19BrN2O5 — CID 7971512
[(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate (PubChem CID 7971512) has the molecular formula C16H19BrN2O5 and a molecular weight of 399.24 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7971512 |
| Molecular Formula | C16H19BrN2O5 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] (E)-3-(5-bromo-2-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)O[C@H](C(=O)NC(N)=O)C(C)C |
| InChI | InChI=1S/C16H19BrN2O5/c1-9(2)14(15(21)19-16(18)22)24-13(20)7-4-10-8-11(17)5-6-12(10)23-3/h4-9,14H,1-3H3,(H3,18,19,21,22)/b7-4+/t14-/m0/s1 |
| InChIKey | PDDUUKSJNPKCIY-GBXSZLQWSA-N |
| XLogP | 2.23 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|