C15H17ClN2O4 — CID 7786967
[(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] (E)-3-(2-chlorophenyl)prop-2-enoate (PubChem CID 7786967) has the molecular formula C15H17ClN2O4 and a molecular weight of 324.76 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] (E)-3-(2-chlorophenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] (E)-3-(2-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7786967 |
| Molecular Formula | C15H17ClN2O4 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] (E)-3-(2-chlorophenyl)prop-2-enoate |
| SMILES | CC(C)[C@H](OC(=O)/C=C/c1ccccc1Cl)C(=O)NC(N)=O |
| InChI | InChI=1S/C15H17ClN2O4/c1-9(2)13(14(20)18-15(17)21)22-12(19)8-7-10-5-3-4-6-11(10)16/h3-9,13H,1-2H3,(H3,17,18,20,21)/b8-7+/t13-/m0/s1 |
| InChIKey | ZDNOLTPPPDPBSZ-GWJCSSMESA-N |
| XLogP | 2.12 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|