C13H15BrN2O4S — CID 7712550
[(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate (PubChem CID 7712550) has the molecular formula C13H15BrN2O4S and a molecular weight of 375.24 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate.
| Compound Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7712550 |
| Molecular Formula | C13H15BrN2O4S |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] (E)-3-(5-bromothiophen-2-yl)prop-2-enoate |
| SMILES | CC(C)[C@H](OC(=O)/C=C/c1ccc(Br)s1)C(=O)NC(N)=O |
| InChI | InChI=1S/C13H15BrN2O4S/c1-7(2)11(12(18)16-13(15)19)20-10(17)6-4-8-3-5-9(14)21-8/h3-7,11H,1-2H3,(H3,15,16,18,19)/b6-4+/t11-/m0/s1 |
| InChIKey | IMVQRJBGTAYNRW-MALLOTDXSA-N |
| XLogP | 2.29 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|