C19H22N2O3S2 — CID 6213936
(E)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 6213936) has the molecular formula C19H22N2O3S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is (E)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 6213936 |
| Molecular Formula | C19H22N2O3S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | (E)-N-(2-methyl-5-piperidin-1-ylsulfonylphenyl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C19H22N2O3S2/c1-15-7-9-17(26(23,24)21-11-3-2-4-12-21)14-18(15)20-19(22)10-8-16-6-5-13-25-16/h5-10,13-14H,2-4,11-12H2,1H3,(H,20,22)/b10-8+ |
| InChIKey | ZCIGLAMHJQZNMB-CSKARUKUSA-N |
| XLogP | 3.88 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|