C22H26FN3O3S — CID 55344900
N-[2-(dimethylamino)-5-piperidin-1-ylsulfonylphenyl]-3-(2-fluorophenyl)prop-2-enamide (PubChem CID 55344900) has the molecular formula C22H26FN3O3S and a molecular weight of 431.53 g/mol. Its IUPAC name is N-[2-(dimethylamino)-5-piperidin-1-ylsulfonylphenyl]-3-(2-fluorophenyl)prop-2-enamide.
| Compound Name | N-[2-(dimethylamino)-5-piperidin-1-ylsulfonylphenyl]-3-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55344900 |
| Molecular Formula | C22H26FN3O3S |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-[2-(dimethylamino)-5-piperidin-1-ylsulfonylphenyl]-3-(2-fluorophenyl)prop-2-enamide |
| SMILES | CN(C)c1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)C=Cc1ccccc1F |
| InChI | InChI=1S/C22H26FN3O3S/c1-25(2)21-12-11-18(30(28,29)26-14-6-3-7-15-26)16-20(21)24-22(27)13-10-17-8-4-5-9-19(17)23/h4-5,8-13,16H,3,6-7,14-15H2,1-2H3,(H,24,27) |
| InChIKey | SLRRFDPVEBQAOW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|