C24H32N4O4S — CID 26292461
N-[3-[2-(dimethylamino)-5-piperidin-1-ylsulfonylanilino]-3-oxopropyl]-3-methylbenzamide (PubChem CID 26292461) has the molecular formula C24H32N4O4S and a molecular weight of 472.61 g/mol. Its IUPAC name is N-[3-[2-(dimethylamino)-5-piperidin-1-ylsulfonylanilino]-3-oxopropyl]-3-methylbenzamide.
| Compound Name | N-[3-[2-(dimethylamino)-5-piperidin-1-ylsulfonylanilino]-3-oxopropyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 26292461 |
| Molecular Formula | C24H32N4O4S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | N-[3-[2-(dimethylamino)-5-piperidin-1-ylsulfonylanilino]-3-oxopropyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NCCC(=O)Nc2cc(S(=O)(=O)N3CCCCC3)ccc2N(C)C)c1 |
| InChI | InChI=1S/C24H32N4O4S/c1-18-8-7-9-19(16-18)24(30)25-13-12-23(29)26-21-17-20(10-11-22(21)27(2)3)33(31,32)28-14-5-4-6-15-28/h7-11,16-17H,4-6,12-15H2,1-3H3,(H,25,30)(H,26,29) |
| InChIKey | OXXIVWOLVCKOSV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |