C22H27N3O5S — CID 17226232
3-methoxy-N-[3-oxo-3-(4-piperidin-1-ylsulfonylanilino)propyl]benzamide (PubChem CID 17226232) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is 3-methoxy-N-[3-oxo-3-(4-piperidin-1-ylsulfonylanilino)propyl]benzamide.
| Compound Name | 3-methoxy-N-[3-oxo-3-(4-piperidin-1-ylsulfonylanilino)propyl]benzamide |
|---|---|
| PubChem CID | 17226232 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 3-methoxy-N-[3-oxo-3-(4-piperidin-1-ylsulfonylanilino)propyl]benzamide |
| SMILES | COc1cccc(C(=O)NCCC(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C22H27N3O5S/c1-30-19-7-5-6-17(16-19)22(27)23-13-12-21(26)24-18-8-10-20(11-9-18)31(28,29)25-14-3-2-4-15-25/h5-11,16H,2-4,12-15H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | DVNDERBYPOAUTG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |