C23H29N3O6S — CID 17191768
3,5-dimethoxy-N-[3-oxo-3-(4-piperidin-1-ylsulfonylanilino)propyl]benzamide (PubChem CID 17191768) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[3-oxo-3-(4-piperidin-1-ylsulfonylanilino)propyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[3-oxo-3-(4-piperidin-1-ylsulfonylanilino)propyl]benzamide |
|---|---|
| PubChem CID | 17191768 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 3,5-dimethoxy-N-[3-oxo-3-(4-piperidin-1-ylsulfonylanilino)propyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCCC(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C23H29N3O6S/c1-31-19-14-17(15-20(16-19)32-2)23(28)24-11-10-22(27)25-18-6-8-21(9-7-18)33(29,30)26-12-4-3-5-13-26/h6-9,14-16H,3-5,10-13H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | RVDBYNKDXMHGFF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |