C16H13BrF3NO2S — CID 60575097
(E)-3-(5-bromothiophen-2-yl)-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide (PubChem CID 60575097) has the molecular formula C16H13BrF3NO2S and a molecular weight of 420.25 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 60575097 |
| Molecular Formula | C16H13BrF3NO2S |
| Molecular Weight | 420.25 g/mol |
| Exact Mass | 418.98 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C=C/c2ccc(Br)s2)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C16H13BrF3NO2S/c1-10-2-5-12(13(8-10)23-9-16(18,19)20)21-15(22)7-4-11-3-6-14(17)24-11/h2-8H,9H2,1H3,(H,21,22)/b7-4+ |
| InChIKey | VKFGIDIVZXGAQV-QPJJXVBHSA-N |
| XLogP | 5.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.25 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|