C18H15F4NO2 — CID 60575425
(E)-3-(4-fluorophenyl)-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide (PubChem CID 60575425) has the molecular formula C18H15F4NO2 and a molecular weight of 353.32 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 60575425 |
| Molecular Formula | C18H15F4NO2 |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[4-methyl-2-(2,2,2-trifluoroethoxy)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C=C/c2ccc(F)cc2)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F4NO2/c1-12-2-8-15(16(10-12)25-11-18(20,21)22)23-17(24)9-5-13-3-6-14(19)7-4-13/h2-10H,11H2,1H3,(H,23,24)/b9-5+ |
| InChIKey | LNXQXZXAGUSYIM-WEVVVXLNSA-N |
| XLogP | 4.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|