C15H12BrF3N2O2S — CID 39501542
(E)-3-(5-bromothiophen-2-yl)-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]prop-2-enamide (PubChem CID 39501542) has the molecular formula C15H12BrF3N2O2S and a molecular weight of 421.24 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 39501542 |
| Molecular Formula | C15H12BrF3N2O2S |
| Molecular Weight | 421.24 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)s1)NCc1ccnc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C15H12BrF3N2O2S/c16-12-3-1-11(24-12)2-4-13(22)21-8-10-5-6-20-14(7-10)23-9-15(17,18)19/h1-7H,8-9H2,(H,21,22)/b4-2+ |
| InChIKey | WBAKFPWFAHJAKS-DUXPYHPUSA-N |
| XLogP | 4.18 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.24 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|