C18H15F5N2O3 — CID 39502476
(E)-3-[2-(difluoromethoxy)phenyl]-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]prop-2-enamide (PubChem CID 39502476) has the molecular formula C18H15F5N2O3 and a molecular weight of 402.32 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 39502476 |
| Molecular Formula | C18H15F5N2O3 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1OC(F)F)NCc1ccnc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C18H15F5N2O3/c19-17(20)28-14-4-2-1-3-13(14)5-6-15(26)25-10-12-7-8-24-16(9-12)27-11-18(21,22)23/h1-9,17H,10-11H2,(H,25,26)/b6-5+ |
| InChIKey | ZGLDAVUPACBYPM-AATRIKPKSA-N |
| XLogP | 3.95 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|