C17H14INO2S — CID 175653376
2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium iodide (PubChem CID 175653376) has the molecular formula C17H14INO2S and a molecular weight of 423.28 g/mol. Its IUPAC name is 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium iodide.
| Compound Name | 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium iodide |
|---|---|
| PubChem CID | 175653376 |
| Molecular Formula | C17H14INO2S |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 422.98 |
| IUPAC Name | 2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-3-methyl-1,3-benzothiazol-3-ium iodide |
| SMILES | C[n+]1c(/C=C/c2ccc3c(c2)OCO3)sc2ccccc21.[I-] |
| InChI | InChI=1S/C17H14NO2S.HI/c1-18-13-4-2-3-5-16(13)21-17(18)9-7-12-6-8-14-15(10-12)20-11-19-14;/h2-10H,11H2,1H3;1H/q+1;/p-1/b9-7+; |
| InChIKey | OPEHGWNNASRKFJ-BXTVWIJMSA-M |
| XLogP | 0.63 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|