C19H17NO5S2 — CID 22331886
3-[2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate (PubChem CID 22331886) has the molecular formula C19H17NO5S2 and a molecular weight of 403.48 g/mol. Its IUPAC name is 3-[2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 22331886 |
| Molecular Formula | C19H17NO5S2 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 3-[2-[(E)-2-(1,3-benzodioxol-5-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCC[n+]1c(/C=C/c2ccc3c(c2)OCO3)sc2ccccc21 |
| InChI | InChI=1S/C19H17NO5S2/c21-27(22,23)11-3-10-20-15-4-1-2-5-18(15)26-19(20)9-7-14-6-8-16-17(12-14)25-13-24-16/h1-2,4-9,12H,3,10-11,13H2/b9-7+ |
| InChIKey | AYNVMYUUSZGALU-VQHVLOKHSA-N |
| XLogP | 3.02 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|