C29H37NO5S6 — CID 177493447
4-[2-[(E)-2-(2,17-dioxa-5,8,11,14-tetrathiabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonate (PubChem CID 177493447) has the molecular formula C29H37NO5S6 and a molecular weight of 672.02 g/mol. Its IUPAC name is 4-[2-[(E)-2-(2,17-dioxa-5,8,11,14-tetrathiabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonate.
| Compound Name | 4-[2-[(E)-2-(2,17-dioxa-5,8,11,14-tetrathiabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 177493447 |
| Molecular Formula | C29H37NO5S6 |
| Molecular Weight | 672.02 g/mol |
| Exact Mass | 671.10 |
| IUPAC Name | 4-[2-[(E)-2-(2,17-dioxa-5,8,11,14-tetrathiabicyclo[16.4.0]docosa-1(18),19,21-trien-20-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCC[n+]1c(/C=C/c2ccc3c(c2)OCCSCCSCCSCCSCCO3)sc2ccccc21 |
| InChI | InChI=1S/C29H37NO5S6/c31-41(32,33)22-4-3-11-30-25-5-1-2-6-28(25)40-29(30)10-8-24-7-9-26-27(23-24)35-13-15-37-17-19-39-21-20-38-18-16-36-14-12-34-26/h1-2,5-10,23H,3-4,11-22H2/b10-8+ |
| InChIKey | SCQLMTWHWCNBKB-CSKARUKUSA-N |
| XLogP | 6.39 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.02 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|