C36H33NNaO4S2+ — CID 59137884
sodium 4-[2-[4-(2,4-diphenyl-6,7-dihydro-5H-chromen-8-yl)buta-1,3-dienyl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonate (PubChem CID 59137884) has the molecular formula C36H33NNaO4S2+ and a molecular weight of 630.79 g/mol. Its IUPAC name is sodium 4-[2-[4-(2,4-diphenyl-6,7-dihydro-5H-chromen-8-yl)buta-1,3-dienyl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonate.
| Compound Name | sodium 4-[2-[4-(2,4-diphenyl-6,7-dihydro-5H-chromen-8-yl)buta-1,3-dienyl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 59137884 |
| Molecular Formula | C36H33NNaO4S2+ |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.17 |
| IUPAC Name | sodium 4-[2-[4-(2,4-diphenyl-6,7-dihydro-5H-chromen-8-yl)buta-1,3-dienyl]-1,3-benzothiazol-3-ium-3-yl]butane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCC[n+]1c(C=CC=CC2=C3OC(c4ccccc4)=CC(c4ccccc4)=C3CCC2)sc2ccccc21.[Na+] |
| InChI | InChI=1S/C36H33NO4S2.Na/c38-43(39,40)25-12-11-24-37-32-21-8-9-22-34(32)42-35(37)23-10-7-18-29-19-13-20-30-31(27-14-3-1-4-15-27)26-33(41-36(29)30)28-16-5-2-6-17-28;/h1-10,14-18,21-23,26H,11-13,19-20,24-25H2;/q;+1 |
| InChIKey | UWIVELRQWBCPCM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 70.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|