C28H37N2O7S2+ — CID 100953283
3-[2-[2-[4-(1,4,7,10-tetraoxa-13-azoniacyclopentadec-13-yl)phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate (PubChem CID 100953283) has the molecular formula C28H37N2O7S2+ and a molecular weight of 577.75 g/mol. Its IUPAC name is 3-[2-[2-[4-(1,4,7,10-tetraoxa-13-azoniacyclopentadec-13-yl)phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[2-[4-(1,4,7,10-tetraoxa-13-azoniacyclopentadec-13-yl)phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 100953283 |
| Molecular Formula | C28H37N2O7S2+ |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | 3-[2-[2-[4-(1,4,7,10-tetraoxa-13-azoniacyclopentadec-13-yl)phenyl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCC[n+]1c(C=Cc2ccc([NH+]3CCOCCOCCOCCOCC3)cc2)sc2ccccc21 |
| InChI | InChI=1S/C28H36N2O7S2/c31-39(32,33)23-3-12-30-26-4-1-2-5-27(26)38-28(30)11-8-24-6-9-25(10-7-24)29-13-15-34-17-19-36-21-22-37-20-18-35-16-14-29/h1-2,4-11H,3,12-23H2/p+1 |
| InChIKey | UDPKNMLPFPJNHZ-UHFFFAOYSA-O |
| XLogP | 1.89 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|