C17H14ClN3O3S3 — CID 135874996
3-[2-[(E)-2-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate (PubChem CID 135874996) has the molecular formula C17H14ClN3O3S3 and a molecular weight of 439.97 g/mol. Its IUPAC name is 3-[2-[(E)-2-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[(E)-2-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 135874996 |
| Molecular Formula | C17H14ClN3O3S3 |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | 3-[2-[(E)-2-(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)ethenyl]-1,3-benzothiazol-3-ium-3-yl]propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCC[n+]1c(/C=C/c2c(Cl)nc3sccn23)sc2ccccc21 |
| InChI | InChI=1S/C17H14ClN3O3S3/c18-16-13(21-9-10-25-17(21)19-16)6-7-15-20(8-3-11-27(22,23)24)12-4-1-2-5-14(12)26-15/h1-2,4-7,9-10H,3,8,11H2 |
| InChIKey | AKQUVAQHWIKUNW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|