C31H26NOS+ — CID 35340404
2-[2-(2,4-diphenyl-5,6-dihydrocyclopenta[b]pyran-7-yl)ethenyl]-3-ethyl-1,3-benzothiazol-3-ium (PubChem CID 35340404) has the molecular formula C31H26NOS+ and a molecular weight of 460.62 g/mol. Its IUPAC name is 2-[2-(2,4-diphenyl-5,6-dihydrocyclopenta[b]pyran-7-yl)ethenyl]-3-ethyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[2-(2,4-diphenyl-5,6-dihydrocyclopenta[b]pyran-7-yl)ethenyl]-3-ethyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 35340404 |
| Molecular Formula | C31H26NOS+ |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-[2-(2,4-diphenyl-5,6-dihydrocyclopenta[b]pyran-7-yl)ethenyl]-3-ethyl-1,3-benzothiazol-3-ium |
| SMILES | CC[n+]1c(C=CC2=C3OC(c4ccccc4)=CC(c4ccccc4)=C3CC2)sc2ccccc21 |
| InChI | InChI=1S/C31H26NOS/c1-2-32-27-15-9-10-16-29(27)34-30(32)20-18-24-17-19-25-26(22-11-5-3-6-12-22)21-28(33-31(24)25)23-13-7-4-8-14-23/h3-16,18,20-21H,2,17,19H2,1H3/q+1 |
| InChIKey | CTQWXZDOFVKZTI-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|