C23H25N2S+ — CID 59809417
2-[2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-3-ethyl-1,3-benzothiazol-3-ium (PubChem CID 59809417) has the molecular formula C23H25N2S+ and a molecular weight of 361.53 g/mol. Its IUPAC name is 2-[2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-3-ethyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-3-ethyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 59809417 |
| Molecular Formula | C23H25N2S+ |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-[2-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]-3-ethyl-1,3-benzothiazol-3-ium |
| SMILES | CC[n+]1c(C=Cc2cc3c4c(c2)CCCN4CCC3)sc2ccccc21 |
| InChI | InChI=1S/C23H25N2S/c1-2-25-20-9-3-4-10-21(20)26-22(25)12-11-17-15-18-7-5-13-24-14-6-8-19(16-17)23(18)24/h3-4,9-12,15-16H,2,5-8,13-14H2,1H3/q+1 |
| InChIKey | QYGPDOSSIFPXMA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|