C24H25N2S+ — CID 10813553
2-[(E)-2-[4-(azepan-1-yl)phenyl]ethenyl]-3-prop-2-ynyl-1,3-benzothiazol-3-ium (PubChem CID 10813553) has the molecular formula C24H25N2S+ and a molecular weight of 373.55 g/mol. Its IUPAC name is 2-[(E)-2-[4-(azepan-1-yl)phenyl]ethenyl]-3-prop-2-ynyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[(E)-2-[4-(azepan-1-yl)phenyl]ethenyl]-3-prop-2-ynyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 10813553 |
| Molecular Formula | C24H25N2S+ |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2-[(E)-2-[4-(azepan-1-yl)phenyl]ethenyl]-3-prop-2-ynyl-1,3-benzothiazol-3-ium |
| SMILES | C#CC[n+]1c(/C=C/c2ccc(N3CCCCCC3)cc2)sc2ccccc21 |
| InChI | InChI=1S/C24H25N2S/c1-2-17-26-22-9-5-6-10-23(22)27-24(26)16-13-20-11-14-21(15-12-20)25-18-7-3-4-8-19-25/h1,5-6,9-16H,3-4,7-8,17-19H2/q+1 |
| InChIKey | IJAARHPHBIISQI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|