C23H23BrN2S — CID 10575053
2-[(E)-2-(4-piperidin-1-ylphenyl)ethenyl]-3-prop-2-ynyl-1,3-benzothiazol-3-ium bromide (PubChem CID 10575053) has the molecular formula C23H23BrN2S and a molecular weight of 439.42 g/mol. Its IUPAC name is 2-[(E)-2-(4-piperidin-1-ylphenyl)ethenyl]-3-prop-2-ynyl-1,3-benzothiazol-3-ium bromide.
| Compound Name | 2-[(E)-2-(4-piperidin-1-ylphenyl)ethenyl]-3-prop-2-ynyl-1,3-benzothiazol-3-ium bromide |
|---|---|
| PubChem CID | 10575053 |
| Molecular Formula | C23H23BrN2S |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 2-[(E)-2-(4-piperidin-1-ylphenyl)ethenyl]-3-prop-2-ynyl-1,3-benzothiazol-3-ium bromide |
| SMILES | C#CC[n+]1c(/C=C/c2ccc(N3CCCCC3)cc2)sc2ccccc21.[Br-] |
| InChI | InChI=1S/C23H23N2S.BrH/c1-2-16-25-21-8-4-5-9-22(21)26-23(25)15-12-19-10-13-20(14-11-19)24-17-6-3-7-18-24;/h1,4-5,8-15H,3,6-7,16-18H2;1H/q+1;/p-1 |
| InChIKey | GDWFWDDJPHCINN-UHFFFAOYSA-M |
| XLogP | 1.99 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|