C21H18N3S+ — CID 10764780
2-[(E)-2-(4-imidazol-1-ylphenyl)ethenyl]-3-prop-2-enyl-1,3-benzothiazol-3-ium (PubChem CID 10764780) has the molecular formula C21H18N3S+ and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-[(E)-2-(4-imidazol-1-ylphenyl)ethenyl]-3-prop-2-enyl-1,3-benzothiazol-3-ium.
| Compound Name | 2-[(E)-2-(4-imidazol-1-ylphenyl)ethenyl]-3-prop-2-enyl-1,3-benzothiazol-3-ium |
|---|---|
| PubChem CID | 10764780 |
| Molecular Formula | C21H18N3S+ |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-[(E)-2-(4-imidazol-1-ylphenyl)ethenyl]-3-prop-2-enyl-1,3-benzothiazol-3-ium |
| SMILES | C=CC[n+]1c(/C=C/c2ccc(-n3ccnc3)cc2)sc2ccccc21 |
| InChI | InChI=1S/C21H18N3S/c1-2-14-24-19-5-3-4-6-20(19)25-21(24)12-9-17-7-10-18(11-8-17)23-15-13-22-16-23/h2-13,15-16H,1,14H2/q+1 |
| InChIKey | YGPBJRIFEUPBBP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|