C23H24BrN3S — CID 10527694
2-[(E)-2-[4-(4-methylpiperazin-1-yl)phenyl]ethenyl]-3-prop-2-ynyl-1,3-benzothiazol-3-ium bromide (PubChem CID 10527694) has the molecular formula C23H24BrN3S and a molecular weight of 454.44 g/mol. Its IUPAC name is 2-[(E)-2-[4-(4-methylpiperazin-1-yl)phenyl]ethenyl]-3-prop-2-ynyl-1,3-benzothiazol-3-ium bromide.
| Compound Name | 2-[(E)-2-[4-(4-methylpiperazin-1-yl)phenyl]ethenyl]-3-prop-2-ynyl-1,3-benzothiazol-3-ium bromide |
|---|---|
| PubChem CID | 10527694 |
| Molecular Formula | C23H24BrN3S |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 2-[(E)-2-[4-(4-methylpiperazin-1-yl)phenyl]ethenyl]-3-prop-2-ynyl-1,3-benzothiazol-3-ium bromide |
| SMILES | C#CC[n+]1c(/C=C/c2ccc(N3CCN(C)CC3)cc2)sc2ccccc21.[Br-] |
| InChI | InChI=1S/C23H24N3S.BrH/c1-3-14-26-21-6-4-5-7-22(21)27-23(26)13-10-19-8-11-20(12-9-19)25-17-15-24(2)16-18-25;/h1,4-13H,14-18H2,2H3;1H/q+1;/p-1 |
| InChIKey | CULYXXFTBSBGAD-UHFFFAOYSA-M |
| XLogP | 0.75 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|